What is the molecular formula of (1S,4S)-2-Boc-2,5-diazabicyclo[2.2.2]octane hydrochloride?
The molecular formula is C11H21ClN2O2.
What is the molecular weight of (1S,4S)-2-Boc-2,5-diazabicyclo[2.2.2]octane hydrochloride?
The molecular weight is 248.75 g/mol.
What is the IUPAC name of (1S,4S)-2-Boc-2,5-diazabicyclo[2.2.2]octane hydrochloride?
The IUPAC name is tert-butyl (1S,4S)-2,5-diazabicyclo[2.2.2]octane-2-carboxylate;hydrochloride.
What is the InChI of (1S,4S)-2-Boc-2,5-diazabicyclo[2.2.2]octane hydrochloride?
The InChI is InChI=1S/C11H20N2O2.ClH/c1-11(2,3)15-10(14)13-7-8-4-5-9(13)6-12-8;/h8-9,12H,4-7H2,1-3H3;1H/t8-,9-;/m0./s1.
What is the Canonical SMILES of (1S,4S)-2-Boc-2,5-diazabicyclo[2.2.2]octane hydrochloride?
The Canonical SMILES is CC(C)(C)OC(=O)N1CC2CCC1CN2.Cl.
What is the Hydrogen Bond Donor Count of (1S,4S)-2-Boc-2,5-diazabicyclo[2.2.2]octane hydrochloride?
The Hydrogen Bond Donor Count is 2.
What is the Hydrogen Bond Acceptor Count of (1S,4S)-2-Boc-2,5-diazabicyclo[2.2.2]octane hydrochloride?
The Hydrogen Bond Acceptor Count is 3.
What is the Rotatable Bond Count of (1S,4S)-2-Boc-2,5-diazabicyclo[2.2.2]octane hydrochloride?
The Rotatable Bond Count is 2.
What is the Exact Mass of (1S,4S)-2-Boc-2,5-diazabicyclo[2.2.2]octane hydrochloride?
The Exact Mass is 248.1291556 g/mol.
Is (1S,4S)-2-Boc-2,5-diazabicyclo[2.2.2]octane hydrochloride a canonicalized compound?
Yes, it is a canonicalized compound.