What is the molecular formula of L-(-)-Threo-2-imino-3,4-dimethyl-5-phenylthiazolidine?
The molecular formula is C11H14N2S.
What is the molecular weight of L-(-)-Threo-2-imino-3,4-dimethyl-5-phenylthiazolidine?
The molecular weight is 206.31 g/mol.
What is the IUPAC name of L-(-)-Threo-2-imino-3,4-dimethyl-5-phenylthiazolidine?
The IUPAC name is 3,4-dimethyl-5-phenyl-1,3-thiazolidin-2-imine.
What is the InChI of L-(-)-Threo-2-imino-3,4-dimethyl-5-phenylthiazolidine?
The InChI is InChI=1S/C11H14N2S/c1-8-10(14-11(12)13(8)2)9-6-4-3-5-7-9/h3-8,10,12H,1-2H3.
What is the InChIKey of L-(-)-Threo-2-imino-3,4-dimethyl-5-phenylthiazolidine?
The InChIKey is GMFUTRCIEWHKBH-UHFFFAOYSA-N.
What is the canonical SMILES of L-(-)-Threo-2-imino-3,4-dimethyl-5-phenylthiazolidine?
The canonical SMILES is CC1C(SC(=N)N1C)C2=CC=CC=C2.
What is the CAS number of L-(-)-Threo-2-imino-3,4-dimethyl-5-phenylthiazolidine?
The CAS number is 14007-67-1.
What is the European Community (EC) number of L-(-)-Threo-2-imino-3,4-dimethyl-5-phenylthiazolidine?
The European Community (EC) number is 213-411-7.
What is the hydrogen bond donor count of L-(-)-Threo-2-imino-3,4-dimethyl-5-phenylthiazolidine?
The hydrogen bond donor count is 1.
What is the topological polar surface area of L-(-)-Threo-2-imino-3,4-dimethyl-5-phenylthiazolidine?
The topological polar surface area is 52.4 ?2.