What is the molecular formula of benzoic acid, 4-amino-2,3,5,6-tetrafluoro?
The molecular formula of benzoic acid, 4-amino-2,3,5,6-tetrafluoro is C7H3F4NO2.
What are the synonyms of 4-amino-2,3,5,6-tetrafluorobenzoic acid?
The synonyms of 4-amino-2,3,5,6-tetrafluorobenzoic acid are 944-43-4, MFCD00007647, 4-AMINO-2,3,5,6-TETRAFLUOROBENZOICACID, and NSC98742.
What is the molecular weight of 4-amino-2,3,5,6-tetrafluorobenzoic acid?
The molecular weight of 4-amino-2,3,5,6-tetrafluorobenzoic acid is 209.10 g/mol.
What is the IUPAC name of 4-amino-2,3,5,6-tetrafluorobenzoic acid?
The IUPAC name of 4-amino-2,3,5,6-tetrafluorobenzoic acid is 4-amino-2,3,5,6-tetrafluorobenzoic acid.
What is the InChI of 4-amino-2,3,5,6-tetrafluorobenzoic acid?
The InChI of 4-amino-2,3,5,6-tetrafluorobenzoic acid is InChI=1S/C7H3F4NO2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H,13,14).
What is the InChIKey of 4-amino-2,3,5,6-tetrafluorobenzoic acid?
The InChIKey of 4-amino-2,3,5,6-tetrafluorobenzoic acid is WTNSXWSOTDBWOR-UHFFFAOYSA-N.
What is the canonical SMILES of 4-amino-2,3,5,6-tetrafluorobenzoic acid?
The canonical SMILES of 4-amino-2,3,5,6-tetrafluorobenzoic acid is C1(=C(C(=C(C(=C1F)F)N)F)F)C(=O)O.
What is the CAS number of 4-amino-2,3,5,6-tetrafluorobenzoic acid?
The CAS number of 4-amino-2,3,5,6-tetrafluorobenzoic acid is 944-43-4.
What is the EC number of 4-amino-2,3,5,6-tetrafluorobenzoic acid?
The EC number of 4-amino-2,3,5,6-tetrafluorobenzoic acid is 213-409-6.