943830-82-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C10H13ClFN.
The molecular weight is 201.67 g/mol.
Some synonyms include 3-(3-FLUOROPHENYL)PYRROLIDINE HCL and 3-(3-fluorophenyl)pyrrolidine;hydrochloride.
The IUPAC name is 3-(3-fluorophenyl)pyrrolidine;hydrochloride.
The InChI is InChI=1S/C10H12FN.ClH/c11-10-3-1-2-8(6-10)9-4-5-12-7-9;/h1-3,6,9,12H,4-5,7H2;1H.
There are 2 hydrogen bond donor counts.
The topological polar surface area is 122.
There are 13 heavy atoms.
Yes, the compound is canonicalized.
The exact mass is 201.0720553 g/mol.
×
Download