What is the molecular formula of 4-Methyl-d3-diphenyl?
C13H12.
What is the molecular weight of 4-Methyl-d3-diphenyl?
The molecular weight is 171.25 g/mol.
What is the IUPAC name of 4-Methyl-d3-diphenyl?
The IUPAC name is 1-phenyl-4-(trideuteriomethyl)benzene.
What is the InChI of 4-Methyl-d3-diphenyl?
The InChI is InChI=1S/C13H12/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12/h2-10H,1H3/i1D3.
What is the InChIKey of 4-Methyl-d3-diphenyl?
The InChIKey is ZZLCFHIKESPLTH-FIBGUPNXSA-N.
What is the canonical SMILES of 4-Methyl-d3-diphenyl?
The canonical SMILES is CC1=CC=C(C=C1)C2=CC=CC=C2.
What is the isomeric SMILES of 4-Methyl-d3-diphenyl?
The isomeric SMILES is [2H]C([2H])([2H])C1=CC=C(C=C1)C2=CC=CC=C2.
What is the XLogP3 value of 4-Methyl-d3-diphenyl?
The XLogP3 value is 4.6.
How many rotatable bonds does 4-Methyl-d3-diphenyl have?
It has 1 rotatable bond.
What is the topological polar surface area of 4-Methyl-d3-diphenyl?
The topological polar surface area is 0-2.