What is the molecular formula of N-succinyl-Leu-Tyr-7-amido-4-methylcoumarin?
The molecular formula is C29H33N3O8.
When was N-succinyl-Leu-Tyr-7-amido-4-methylcoumarin first created in PubChem?
It was first created on December 29, 2008.
What is the molecular weight of N-succinyl-Leu-Tyr-7-amido-4-methylcoumarin?
The molecular weight is 551.6 g/mol.
What are some synonyms for N-succinyl-Leu-Tyr-7-amido-4-methylcoumarin?
Some synonyms include Suc-Leu-Tyr-AMC, Suc-LY-AMC, and Suc-leu-tyr-nhmec.
What is the IUPAC name of N-succinyl-Leu-Tyr-7-amido-4-methylcoumarin?
The IUPAC name is 4-[[(2S)-1-[[(2S)-3-(4-hydroxyphenyl)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-oxobutanoic acid.
What is the Canonical SMILES of N-succinyl-Leu-Tyr-7-amido-4-methylcoumarin?
The Canonical SMILES is CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(CC3=CC=C(C=C3)O)NC(=O)C(CC(C)C)NC(=O)CCC(=O)O.
What is the InChIKey of N-succinyl-Leu-Tyr-7-amido-4-methylcoumarin?
The InChIKey is RIYLNECMTVNMSO-GOTSBHOMSA-N.
How many hydrogen bond donor counts does N-succinyl-Leu-Tyr-7-amido-4-methylcoumarin have?
It has 5 hydrogen bond donor counts.
What is the topological polar surface area of N-succinyl-Leu-Tyr-7-amido-4-methylcoumarin?
The topological polar surface area is 171 Ų.
How many rotatable bond counts does N-succinyl-Leu-Tyr-7-amido-4-methylcoumarin have?
It has 12 rotatable bond counts.
※ Please kindly note that our products are for research use only.