What is the molecular formula of Potassium 2-hydrazono-2,3-dihydro-3-methylbenzothiazole-5-sulfonate?
The molecular formula is C8H8KN3O3S2.
What is the molecular weight of Potassium 2-hydrazono-2,3-dihydro-3-methylbenzothiazole-5-sulfonate?
The molecular weight is 297.4 g/mol.
When was Potassium 2-hydrazono-2,3-dihydro-3-methylbenzothiazole-5-sulfonate created in PubChem?
It was created on February 5, 2008.
What is the IUPAC name of Potassium 2-hydrazono-2,3-dihydro-3-methylbenzothiazole-5-sulfonate?
The IUPAC name is potassium;(2E)-2-hydrazinylidene-3-methyl-1,3-benzothiazole-5-sulfonate.
What is the Canonical SMILES of Potassium 2-hydrazono-2,3-dihydro-3-methylbenzothiazole-5-sulfonate?
The Canonical SMILES is CN1C2=C(C=CC(=C2)S(=O)(=O)[O-])SC1=NN.[K+].
What is the CAS number of Potassium 2-hydrazono-2,3-dihydro-3-methylbenzothiazole-5-sulfonate?
The CAS number is 94349-57-2.
How many Hydrogen Bond Donor Counts does Potassium 2-hydrazono-2,3-dihydro-3-methylbenzothiazole-5-sulfonate have?
It has 1 Hydrogen Bond Donor Count.
What is the Hydrogen Bond Acceptor Count of Potassium 2-hydrazono-2,3-dihydro-3-methylbenzothiazole-5-sulfonate?
It has 6 Hydrogen Bond Acceptor Count.
What is the Topological Polar Surface Area of Potassium 2-hydrazono-2,3-dihydro-3-methylbenzothiazole-5-sulfonate?
The Topological Polar Surface Area is 133Å2.
Is Potassium 2-hydrazono-2,3-dihydro-3-methylbenzothiazole-5-sulfonate a canonicalized compound?
Yes, it is a canonicalized compound.