What is the molecular formula of Lithium hydrogen malate?
The molecular formula of Lithium hydrogen malate is C4H5LiO5.
What is the molecular weight of Lithium hydrogen malate?
The molecular weight of Lithium hydrogen malate is 140.0 g/mol.
What are the synonyms for Lithium hydrogen malate?
Some synonyms for Lithium hydrogen malate include hydrogen malate lithium and EINECS 305-026-9.
What is the IUPAC name of Lithium hydrogen malate?
The IUPAC name of Lithium hydrogen malate is lithium;3,4-dihydroxy-4-oxobutanoate.
What is the canonical SMILES for Lithium hydrogen malate?
The canonical SMILES for Lithium hydrogen malate is [Li+].C(C(C(=O)O)O)C(=O)[O-].
What is the InChIKey for Lithium hydrogen malate?
The InChIKey for Lithium hydrogen malate is DSNICULMAZJWBF-UHFFFAOYSA-M.
How many hydrogen bond donor counts does Lithium hydrogen malate have?
Lithium hydrogen malate has 2 hydrogen bond donor counts.
What is the exact mass of Lithium hydrogen malate?
The exact mass of Lithium hydrogen malate is 140.02970169 g/mol.
Does Lithium hydrogen malate have any isotope atom count?
No, Lithium hydrogen malate does not have any isotope atom count.
Is Lithium hydrogen malate a canonicalized compound?
Yes, Lithium hydrogen malate is a canonicalized compound.