What is the molecular formula of 2,3,5-Trimethyl-4-phenyltetrahydrofuran?
The molecular formula is C13H18O.
When was 2,3,5-Trimethyl-4-phenyltetrahydrofuran created and last modified?
It was created on 2005-08-08 and last modified on 2023-12-30.
What is the IUPAC Name of 2,3,5-Trimethyl-4-phenyltetrahydrofuran?
The IUPAC Name is 2,3,5-trimethyl-4-phenyloxolane.
What is the InChI of 2,3,5-Trimethyl-4-phenyltetrahydrofuran?
The InChI is InChI=1S/C13H18O/c1-9-10(2)14-11(3)13(9)12-7-5-4-6-8-12/h4-11,13H,1-3H3.
How many hydrogen bond acceptor counts are present in 2,3,5-Trimethyl-4-phenyltetrahydrofuran?
There is 1 hydrogen bond acceptor count.
What is the exact mass of 2,3,5-Trimethyl-4-phenyltetrahydrofuran?
The exact mass is 190.135765193 g/mol.
How many defined atom stereocenter counts are there in 2,3,5-Trimethyl-4-phenyltetrahydrofuran?
There are 0 defined atom stereocenter counts.
What is the XLogP3-AA value of 2,3,5-Trimethyl-4-phenyltetrahydrofuran?
The XLogP3-AA value is 3.3.
How many topological polar surface areas does 2,3,5-Trimethyl-4-phenyltetrahydrofuran have?
It has a topological polar surface area of 9.2 Ų.
Is 2,3,5-Trimethyl-4-phenyltetrahydrofuran canonicalized?
Yes, the compound is canonicalized.