94280-13-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H21NO4.
The molecular weight of the compound is 243.30 g/mol.
The IUPAC name of the compound is ethyl 1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclopropane-1-carboxylate.
The InChI of the compound is InChI=1S/C12H21NO4/c1-5-16-9(14)12(6-7-12)8-13-10(15)17-11(2,3)4/h5-8H2,1-4H3,(H,13,15).
The InChIKey of the compound is XKYUYACGMLEKCC-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCOC(=O)C1(CC1)CNC(=O)OC(C)(C)C.
The CAS number of the compound is 942830-53-7.
The XLogP3-AA value of the compound is 1.5.
There is one hydrogen bond donor in the compound.
Yes, the compound is canonicalized.