What is the molecular formula of morpholine-4-carboxamide?
The molecular formula of morpholine-4-carboxamide is C5H10N2O2.
What is the molecular weight of morpholine-4-carboxamide?
The molecular weight of morpholine-4-carboxamide is 130.15 g/mol.
What is the IUPAC name of morpholine-4-carboxamide?
The IUPAC name of morpholine-4-carboxamide is morpholine-4-carboxamide.
What is the InChI of morpholine-4-carboxamide?
The InChI of morpholine-4-carboxamide is InChI=1S/C5H10N2O2/c6-5(8)7-1-3-9-4-2-7/h1-4H2,(H2,6,8).
What is the InChIKey of morpholine-4-carboxamide?
The InChIKey of morpholine-4-carboxamide is ZKWFSTHEYLJLEL-UHFFFAOYSA-N.
What is the canonical SMILES of morpholine-4-carboxamide?
The canonical SMILES of morpholine-4-carboxamide is C1COCCN1C(=O)N.
What is the CAS number of morpholine-4-carboxamide?
The CAS number of morpholine-4-carboxamide is 2158-02-3.
What is the European Community (EC) number of morpholine-4-carboxamide?
The European Community (EC) number of morpholine-4-carboxamide is 218-474-4.
What is the DSSTox Substance ID of morpholine-4-carboxamide?
The DSSTox Substance ID of morpholine-4-carboxamide is DTXSID10175930.