94-26-38 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H22O.
The synonyms for the compound are EINECS 304-401-4 and 94265-96-0.
The molecular weight of the compound is 194.31 g/mol.
The IUPAC name of the compound is (4aR,7S,8aR)-3,3,6,7-tetramethyl-1,4,4a,7,8,8a-hexahydroisochromene.
The InChI of the compound is InChI=1S/C13H22O/c1-9-5-11-7-13(3,4)14-8-12(11)6-10(9)2/h5,10-12H,6-8H2,1-4H3/t10-,11-,12-/m0/s1.
The InChIKey of the compound is HIHXXYCXFIAFGQ-SRVKXCTJSA-N.
The canonical SMILES of the compound is CC1CC2COC(CC2C=C1C)(C)C.
The isomeric SMILES of the compound is C[C@H]1C[C@H]2COC(C[C@@H]2C=C1C)(C)C.
The CAS number of the compound is 94265-96-0.
Yes, the compound is canonicalized.