942631-77-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H18O.
The synonyms of the compound are EINECS 304-400-9, 4-Bicyclo(2.2.1)hept-5-en-2-yl-3-methyl-3-buten-2-ol, and 94265-95-9.
The molecular weight of the compound is 178.27 g/mol.
The IUPAC name of the compound is (E)-4-(2-bicyclo[2.2.1]hept-5-enyl)-3-methylbut-3-en-2-ol.
The InChI code of the compound is InChI=1S/C12H18O/c1-8(9(2)13)5-12-7-10-3-4-11(12)6-10/h3-5,9-13H,6-7H2,1-2H3/b8-5+.
The InChIKey of the compound is LUAIZEQJXRXHQC-VMPITWQZSA-N.
The canonical SMILES of the compound is CC(C(=CC1CC2CC1C=C2)C)O.
The isomeric SMILES of the compound is CC(/C(=C/C1CC2CC1C=C2)/C)O.
The CAS number of the compound is 94265-95-9.
The formal charge of the compound is 0.