What is the molecular formula of Thiobis(tert-octane)?
The molecular formula of Thiobis(tert-octane) is C16H34S.
When was Thiobis(tert-octane) created?
Thiobis(tert-octane) was created on December 5, 2007.
What is the IUPAC name of Thiobis(tert-octane)?
The IUPAC name of Thiobis(tert-octane) is 2-methyl-2-(2-methylheptan-2-ylsulfanyl)heptane.
What is the molecular weight of Thiobis(tert-octane)?
The molecular weight of Thiobis(tert-octane) is 258.5 g/mol.
What is the Canonical SMILES representation of Thiobis(tert-octane)?
The Canonical SMILES representation of Thiobis(tert-octane) is CCCCCC(C)(C)SC(C)(C)CCCCC.
How many hydrogen bond donor count does Thiobis(tert-octane) have?
Thiobis(tert-octane) has 0 hydrogen bond donor count.
What is the XLogP3-AA value for Thiobis(tert-octane)?
The XLogP3-AA value for Thiobis(tert-octane) is 6.8.
What is the topological polar surface area value for Thiobis(tert-octane)?
The topological polar surface area value for Thiobis(tert-octane) is 25.3 Ų.
How many rotatable bond count does Thiobis(tert-octane) have?
Thiobis(tert-octane) has 10 rotatable bond count.
Is the compound canonicalized for Thiobis(tert-octane)?
Yes, the compound is canonicalized for Thiobis(tert-octane).
Download
