What is the molecular formula of N-D-Gluconoyl-L-arginine?
The molecular formula of N-D-Gluconoyl-L-arginine is C12H24N4O8.
When was N-D-Gluconoyl-L-arginine created?
N-D-Gluconoyl-L-arginine was created on August 20, 2009.
What is the molecular weight of N-D-Gluconoyl-L-arginine?
The molecular weight of N-D-Gluconoyl-L-arginine is 352.34 g/mol.
What is the InChI of N-D-Gluconoyl-L-arginine?
The InChI of N-D-Gluconoyl-L-arginine is InChI=1S/C12H24N4O8/c13-12(14)15-3-1-2-5(11(23)24)16-10(22)9(21)8(20)7(19)6(18)4-17/h5-9,17-21H,1-4H2,(H,16,22)(H,23,24)(H4,13,14,15)/t5-,6+,7+,8-,9+/m0/s1.
What is the canonical SMILES of N-D-Gluconoyl-L-arginine?
The canonical SMILES of N-D-Gluconoyl-L-arginine is C(CC(C(=O)O)NC(=O)C(C(C(C(CO)O)O)O)O)CN=C(N)N.
What is the XLogP3-AA value of N-D-Gluconoyl-L-arginine?
The XLogP3-AA value of N-D-Gluconoyl-L-arginine is -4.8.
How many hydrogen bond donor counts does N-D-Gluconoyl-L-arginine have?
N-D-Gluconoyl-L-arginine has 9 hydrogen bond donor counts.
What is the exact mass of N-D-Gluconoyl-L-arginine?
The exact mass of N-D-Gluconoyl-L-arginine is 352.15941374 g/mol.
How many defined atom stereocenter counts does N-D-Gluconoyl-L-arginine have?
N-D-Gluconoyl-L-arginine has 5 defined atom stereocenter counts.
Is the compound canonicalized for N-D-Gluconoyl-L-arginine?
Yes, the compound is canonicalized for N-D-Gluconoyl-L-arginine.