94213-13-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C20H19ClN2O4S3.
The molecular weight of the compound is 483.0 g/mol.
The IUPAC name of the compound is cyclohexyl [5-[(4-chlorophenyl)sulfamoyl]-1,3-benzothiazol-2-yl]sulfanylformate.
The InChI code of the compound is InChI=1S/C20H19ClN2O4S3/c21-13-6-8-14(9-7-13)23-30(25,26)16-10-11-18-17(12-16)22-19(28-18)29-20(24)27-15-4-2-1-3-5-15/h6-12,15,23H,1-5H2.
The InChIKey of the compound is WKRUUBJGVXQZJR-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1CCC(CC1)OC(=O)SC2=NC3=C(S2)C=CC(=C3)S(=O)(=O)NC4=CC=C(C=C4)Cl.
The CAS number of the compound is 94213-18-0.
The XLogP3-AA value of the compound is 6.4.
There are 8 hydrogen bond acceptors present in the compound.
There are 7 rotatable bonds present in the compound.