What is the molecular formula of 2,6,10-Trimethylundeca-1,9-dien-4-yl acetate?
The molecular formula is C16H28O2.
When was 2,6,10-Trimethylundeca-1,9-dien-4-yl acetate first created and modified in PubChem?
It was first created on 2005-08-08 and last modified on 2023-12-30.
What is the IUPAC Name of 2,6,10-Trimethylundeca-1,9-dien-4-yl acetate?
The IUPAC Name is 2,6,10-trimethylundeca-1,9-dien-4-yl acetate.
What is the InChI of 2,6,10-Trimethylundeca-1,9-dien-4-yl acetate?
The InChI is InChI=1S/C16H28O2/c1-12(2)8-7-9-14(5)11-16(10-13(3)4)18-15(6)17/h8,14,16H,3,7,9-11H2,1-2,4-6H3.
What is the molecular weight of 2,6,10-Trimethylundeca-1,9-dien-4-yl acetate?
The molecular weight is 252.39 g/mol.
How many hydrogen bond donor counts does 2,6,10-Trimethylundeca-1,9-dien-4-yl acetate have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of 2,6,10-Trimethylundeca-1,9-dien-4-yl acetate?
The topological polar surface area is 26.3 Ų.
Is 2,6,10-Trimethylundeca-1,9-dien-4-yl acetate a canonicalized compound?
Yes, it is canonicalized.
How many rotatable bond counts does 2,6,10-Trimethylundeca-1,9-dien-4-yl acetate have?
It has 9 rotatable bond counts.
What is the XLogP3-AA value of 2,6,10-Trimethylundeca-1,9-dien-4-yl acetate?
The XLogP3-AA value is 5.6.