What is the molecular formula of 2-Tetradecyloctadecyl palmitate?
The molecular formula of 2-Tetradecyloctadecyl palmitate is C48H96O2.
What is the molecular weight of 2-Tetradecyloctadecyl palmitate?
The molecular weight of 2-Tetradecyloctadecyl palmitate is 705.3 g/mol.
When was 2-Tetradecyloctadecyl palmitate created and last modified?
2-Tetradecyloctadecyl palmitate was created on 2005-08-08 and last modified on 2023-12-30.
What is the IUPAC name of 2-Tetradecyloctadecyl palmitate?
The IUPAC name of 2-Tetradecyloctadecyl palmitate is 2-tetradecyloctadecyl hexadecanoate.
What is the InChI of 2-Tetradecyloctadecyl palmitate?
The InChI of 2-Tetradecyloctadecyl palmitate is InChI=1S/C48H96O2/c1-4-7-10-13-16-19-22-25-27-29-32-35-38-41-44-47(43-40-37-34-31-28-24-21-18-15-12-9-6-3)46-50-48(49)45-42-39-36-33-30-26-23-20-17-14-11-8-5-2/h47H,4-46H2,1-3H3.
What is the InChIKey of 2-Tetradecyloctadecyl palmitate?
The InChIKey of 2-Tetradecyloctadecyl palmitate is IGYMBVVZPQHQLQ-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Tetradecyloctadecyl palmitate?
The Canonical SMILES of 2-Tetradecyloctadecyl palmitate is CCCCCCCCCCCCCCCCC(CCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC.
What is the XLogP3-AA value of 2-Tetradecyloctadecyl palmitate?
The XLogP3-AA value of 2-Tetradecyloctadecyl palmitate is 23.6.
How many hydrogen bond acceptors does 2-Tetradecyloctadecyl palmitate have?
2-Tetradecyloctadecyl palmitate has 2 hydrogen bond acceptors.
Is 2-Tetradecyloctadecyl palmitate a canonicalized compound?
Yes, 2-Tetradecyloctadecyl palmitate is a canonicalized compound.
※ Please kindly note that our products are for research use only.