What is the molecular formula of Pentafluorophenyl 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzoate?
The molecular formula is C18H11F5N2O2.
When was Pentafluorophenyl 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzoate created and last modified?
It was created on 2008-02-29 and last modified on 2023-12-30.
What is the IUPAC Name of Pentafluorophenyl 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzoate?
The IUPAC Name is (2,3,4,5,6-pentafluorophenyl) 4-(3,5-dimethylpyrazol-1-yl)benzoate.
What is the InChIKey of Pentafluorophenyl 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzoate?
The InChIKey is GQQALUKKLLEHOR-UHFFFAOYSA-N.
What is the Canonical SMILES of Pentafluorophenyl 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzoate?
The Canonical SMILES is CC1=CC(=NN1C2=CC=C(C=C2)C(=O)OC3=C(C(=C(C(=C3F)F)F)F)F)C.
What is the molecular weight of Pentafluorophenyl 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzoate?
The molecular weight is 382.3 g/mol.
How many hydrogen bond acceptors does Pentafluorophenyl 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzoate have?
It has 8 hydrogen bond acceptors.
What is the topological polar surface area of Pentafluorophenyl 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzoate?
The topological polar surface area is 44.1 Å^2.
How many rotatable bond counts does Pentafluorophenyl 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzoate have?
It has 4 rotatable bond counts.
Is Pentafluorophenyl 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzoate a canonicalized compound?
Yes, it is canonicalized.