What is the molecular formula of Akos b028887?
The molecular formula of Akos b028887 is C11H13ClO3.
When was Akos b028887 created in PubChem?
Akos b028887 was created in PubChem on July 9, 2005.
What is the computed IUPAC name of Akos b028887?
The computed IUPAC name of Akos b028887 is 2-chloro-5-methoxy-4-propan-2-yloxybenzaldehyde.
What is the InChI of Akos b028887?
The InChI of Akos b028887 is InChI=1S/C11H13ClO3/c1-7(2)15-11-5-9(12)8(6-13)4-10(11)14-3/h4-7H,1-3H3.
What is the InChIKey of Akos b028887?
The InChIKey of Akos b028887 is ORZOULWZVFPKPE-UHFFFAOYSA-N.
What is the canonical SMILES of Akos b028887?
The canonical SMILES of Akos b028887 is CC(C)OC1=C(C=C(C(=C1)Cl)C=O)OC.
What is the molecular weight of Akos b028887?
The molecular weight of Akos b028887 is 228.67 g/mol.
What is the XLogP3-AA value of Akos b028887?
The XLogP3-AA value of Akos b028887 is 2.8.
How many hydrogen bond donor counts does Akos b028887 have?
Akos b028887 has 0 hydrogen bond donor counts.
How many rotatable bond counts does Akos b028887 have?
Akos b028887 has 4 rotatable bond counts.