What is the molecular formula of sodium icos-9-enoate?
The molecular formula of sodium icos-9-enoate is C20H37NaO2.
What is the molecular weight of sodium icos-9-enoate?
The molecular weight of sodium icos-9-enoate is 332.5 g/mol.
What is the IUPAC name of sodium icos-9-enoate?
The IUPAC name of sodium icos-9-enoate is sodium;(Z)-icos-9-enoate.
What is the InChI of sodium icos-9-enoate?
The InChI of sodium icos-9-enoate is InChI=1S/C20H38O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;/h11-12H,2-10,13-19H2,1H3,(H,21,22);/q;+1/p-1/b12-11-.
What is the InChIKey of sodium icos-9-enoate?
The InChIKey of sodium icos-9-enoate is SCEFIDHNJSJIHH-AFEZEDKISA-M.
What is the canonical SMILES of sodium icos-9-enoate?
The canonical SMILES of sodium icos-9-enoate is CCCCCCCCCC=CCCCCCCCC(=O)[O-].[Na+].
What is the isomeric SMILES of sodium icos-9-enoate?
The isomeric SMILES of sodium icos-9-enoate is CCCCCCCCCC/C=C\CCCCCCCC(=O)[O-].[Na+].
What is the CAS number of sodium icos-9-enoate?
The CAS number of sodium icos-9-enoate is 94135-60-1.
What is the European Community (EC) number of sodium icos-9-enoate?
The European Community (EC) number of sodium icos-9-enoate is 302-930-5.
Is sodium icos-9-enoate a canonicalized compound?
Yes, sodium icos-9-enoate is a canonicalized compound.