What is the molecular formula of trisundecyl phosphite?
The molecular formula of trisundecyl phosphite is C33H69O3P.
What is the molecular weight of trisundecyl phosphite?
The molecular weight of trisundecyl phosphite is 544.9 g/mol.
What is the IUPAC name of trisundecyl phosphite?
The IUPAC name of trisundecyl phosphite is triundecyl phosphite.
What is the InChI of trisundecyl phosphite?
The InChI of trisundecyl phosphite is InChI=1S/C33H69O3P/c1-4-7-10-13-16-19-22-25-28-31-34-37(35-32-29-26-23-20-17-14-11-8-5-2)36-33-30-27-24-21-18-15-12-9-6-3/h4-33H2,1-3H3.
What is the InChIKey of trisundecyl phosphite?
The InChIKey of trisundecyl phosphite is UKPASDNOVTUNJT-UHFFFAOYSA-N.
What is the canonical SMILES of trisundecyl phosphite?
The canonical SMILES of trisundecyl phosphite is CCCCCCCCCCCOP(OCCCCCCCCCCC)OCCCCCCCCCCC.
What is the CAS number of trisundecyl phosphite?
The CAS number of trisundecyl phosphite is 94133-78-5.
What is the European Community (EC) number of trisundecyl phosphite?
The European Community (EC) number of trisundecyl phosphite is 302-741-8.
What is the Nikkaji Number of trisundecyl phosphite?
The Nikkaji Number of trisundecyl phosphite is J368.188B.
Is trisundecyl phosphite a canonicalized compound?
Yes, trisundecyl phosphite is a canonicalized compound according to PubChem.