What is the molecular formula of Sorbitan, trioctanoate?
The molecular formula of Sorbitan, trioctanoate is C30H54O8.
When was Sorbitan, trioctanoate created in the PubChem database?
Sorbitan, trioctanoate was created in the PubChem database on August 20, 2009.
What is the molecular weight of Sorbitan, trioctanoate?
The molecular weight of Sorbitan, trioctanoate is 542.7 g/mol.
What is the Canonical SMILES of Sorbitan, trioctanoate?
The Canonical SMILES of Sorbitan, trioctanoate is CCCCCCCC(=O)OC1COC(C1OC(=O)CCCCCCC)C(CO)OC(=O)CCCCCCC.
What is the InChIKey of Sorbitan, trioctanoate?
The InChIKey of Sorbitan, trioctanoate is YPSQXMOPHRARAQ-LPKQAODOSA-N.
How many hydrogen bond donor counts does Sorbitan, trioctanoate have?
Sorbitan, trioctanoate has 1 hydrogen bond donor count.
What is the topological polar surface area of Sorbitan, trioctanoate?
The topological polar surface area of Sorbitan, trioctanoate is 108 Ų.
Is Sorbitan, trioctanoate a canonicalized compound?
Yes, Sorbitan, trioctanoate is a canonicalized compound.
What is the XLogP3-AA value of Sorbitan, trioctanoate?
The XLogP3-AA value of Sorbitan, trioctanoate is 8.1.
How many defined atom stereocenter counts does Sorbitan, trioctanoate have?
Sorbitan, trioctanoate has 4 defined atom stereocenter counts.