What is the molecular formula of Benzenesulfonamide, 2-(3,3,3-trifluoropropyl)?
The molecular formula is C9H10F3NO2S.
What are some synonyms for Benzenesulfonamide, 2-(3,3,3-trifluoropropyl)?
Some synonyms include 2-(3,3,3-trifluoropropyl)benzenesulfonamide and SCHEMBL8610746.
What is the molecular weight of Benzenesulfonamide, 2-(3,3,3-trifluoropropyl)?
The molecular weight is 253.24 g/mol.
When was Benzenesulfonamide, 2-(3,3,3-trifluoropropyl) created and last modified?
It was created on 2006-10-26 and last modified on 2023-12-30.
What is the IUPAC name of Benzenesulfonamide, 2-(3,3,3-trifluoropropyl)?
The IUPAC name is 2-(3,3,3-trifluoropropyl)benzenesulfonamide.
What is the InChI key of Benzenesulfonamide, 2-(3,3,3-trifluoropropyl)?
The InChI key is PIJUMEVHGDAQBH-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Benzenesulfonamide, 2-(3,3,3-trifluoropropyl)?
The Canonical SMILES is C1=CC=C(C(=C1)CCC(F)(F)F)S(=O)(=O)N.
What is the XLogP3 value of Benzenesulfonamide, 2-(3,3,3-trifluoropropyl)?
The XLogP3 value is 2.2.
How many hydrogen bond acceptor counts does Benzenesulfonamide, 2-(3,3,3-trifluoropropyl) have?
It has 6 hydrogen bond acceptor counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.