What is the molecular formula of Disodium 4-(acetylamino)-5-hydroxy-6-(phenylazo)naphthalene-1,7-disulphonate?
The molecular formula is C18H13N3Na2O8S2.
What is the molecular weight of Disodium 4-(acetylamino)-5-hydroxy-6-(phenylazo)naphthalene-1,7-disulphonate?
The molecular weight is 509.4 g/mol.
What are the synonyms for Disodium 4-(acetylamino)-5-hydroxy-6-(phenylazo)naphthalene-1,7-disulphonate?
The synonyms include LIGNIN, Disodium 4-(acetylamino)-5-hydroxy-6-(phenylazo)naphthalene-1,7-disulphonate, and EINECS 302-591-3.
When was Disodium 4-(acetylamino)-5-hydroxy-6-(phenylazo)naphthalene-1,7-disulphonate first created in the database?
It was first created on 2005-08-09.
What are the major components of Lignin, as described in the reference?
Lignin is composed of coniferyl, p-coumaryl, and sinapyl alcohols in varying ratios in different plant species.
What is the InChIKey for Disodium 4-(acetylamino)-5-hydroxy-6-(phenylazo)naphthalene-1,7-disulphonate?
The InChIKey is RLLNZXVKBYGKIP-UHFFFAOYSA-L.
What is the canonical SMILES representation of Disodium 4-(acetylamino)-5-hydroxy-6-(phenylazo)naphthalene-1,7-disulphonate?
CC(=O)NC1=C2C(=C(C=C1)S(=O)(=O)[O-])C=C(C(=C2O)N=NC3=CC=CC=C3)S(=O)(=O)[O-].[Na+].[Na+]
How many hydrogen bond acceptors are there in the structure of Disodium 4-(acetylamino)-5-hydroxy-6-(phenylazo)naphthalene-1,7-disulphonate?
There are 10 hydrogen bond acceptors.
What is the topological polar surface area of Disodium 4-(acetylamino)-5-hydroxy-6-(phenylazo)naphthalene-1,7-disulphonate?
The topological polar surface area is 205 Ų.
How many rotatable bonds are present in the structure of Disodium 4-(acetylamino)-5-hydroxy-6-(phenylazo)naphthalene-1,7-disulphonate?
There are 3 rotatable bonds.