What is the molecular formula of Betaine alpha-D-glucofuranuronate?
The molecular formula of Betaine alpha-D-glucofuranuronate is C11H21NO9.
What are the synonyms of Betaine alpha-D-glucofuranuronate?
The synonyms of Betaine alpha-D-glucofuranuronate are EINECS 302-401-9 and 94108-60-8.
What is the molecular weight of Betaine alpha-D-glucofuranuronate?
The molecular weight of Betaine alpha-D-glucofuranuronate is 311.29 g/mol.
What is the IUPAC Name of Betaine alpha-D-glucofuranuronate?
The IUPAC Name of Betaine alpha-D-glucofuranuronate is carboxymethyl(trimethyl)azanium;(2S)-2-hydroxy-2-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxolan-2-yl]acetate.
What is the InChI of Betaine alpha-D-glucofuranuronate?
The InChI of Betaine alpha-D-glucofuranuronate is InChI=1S/C6H10O7.C5H11NO2/c7-1-2(8)6(12)13-4(1)3(9)5(10)11;1-6(2,3)4-5(7)8/h1-4,6-9,12H,(H,10,11);4H2,1-3H3/t1-,2-,3+,4+,6+;/m1./s1.
What is the InChIKey of Betaine alpha-D-glucofuranuronate?
The InChIKey of Betaine alpha-D-glucofuranuronate is QPYCRBIYNBYSDQ-JETIKSQDSA-N.
What is the canonical SMILES of Betaine alpha-D-glucofuranuronate?
The canonical SMILES of Betaine alpha-D-glucofuranuronate is C[N+](C)(C)CC(=O)O.C1(C(C(OC1C(C(=O)[O-])O)O)O)O.
What is the isomeric SMILES of Betaine alpha-D-glucofuranuronate?
The isomeric SMILES of Betaine alpha-D-glucofuranuronate is C[N+](C)(C)CC(=O)O.[C@H]1([C@H]([C@H](O[C@@H]1[C@@H](C(=O)[O-])O)O)O)O.
What is the CAS number of Betaine alpha-D-glucofuranuronate?
The CAS number of Betaine alpha-D-glucofuranuronate is 94108-60-8.
※ Please kindly note that our products are for research use only.