What is the molecular formula of 1,4,5,8-Tetrakis(4-aminocyclohexyl)anthraquinone?
The molecular formula is C38H52N4O2.
What is the molecular weight of 1,4,5,8-Tetrakis(4-aminocyclohexyl)anthraquinone?
The molecular weight is 596.8 g/mol.
What is the IUPAC name of 1,4,5,8-Tetrakis(4-aminocyclohexyl)anthraquinone?
The IUPAC name is 1,4,5,8-tetrakis(4-aminocyclohexyl)anthracene-9,10-dione.
What is the Canonical SMILES of 1,4,5,8-Tetrakis(4-aminocyclohexyl)anthraquinone?
The Canonical SMILES is C1CC(CCC1C2=C3C(=C(C=C2)C4CCC(CC4)N)C(=O)C5=C(C=CC(=C5C3=O)C6CCC(CC6)N)C7CCC(CC7)N)N.
What is the InChIKey of 1,4,5,8-Tetrakis(4-aminocyclohexyl)anthraquinone?
The InChIKey is VQIKXPKVWOCUFF-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 1,4,5,8-Tetrakis(4-aminocyclohexyl)anthraquinone have?
It has 4 hydrogen bond donor counts.
What is the XLogP3-AA value of 1,4,5,8-Tetrakis(4-aminocyclohexyl)anthraquinone?
The XLogP3-AA value is 4.4.
How many hydrogen bond acceptor counts does 1,4,5,8-Tetrakis(4-aminocyclohexyl)anthraquinone have?
It has 6 hydrogen bond acceptor counts.
What is the Exact Mass of 1,4,5,8-Tetrakis(4-aminocyclohexyl)anthraquinone?
The Exact Mass is 596.40902691 g/mol.
Is 1,4,5,8-Tetrakis(4-aminocyclohexyl)anthraquinone a canonicalized compound?
Yes, it is a canonicalized compound.