The IUPAC name is (2S)-N-(4-methoxynaphthalen-2-yl)-5-oxopyrrolidine-2-carboxamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C16H16N2O3/c1-21-14-9-11(8-10-4-2-3-5-12(10)14)17-16(20)13-6-7-15(19)18-13/h2-5,8-9,13H,6-7H2,1H3,(H,17,20)(H,18,19)/t13-/m0/s1.
What is the InChIKey of the compound?
The InChIKey is KUOSNZTWNCPQEW-ZDUSSCGKSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is COC1=CC(=CC2=CC=CC=C21)NC(=O)C3CCC(=O)N3.
How many hydrogen bond donor count does the compound have?
The compound has 2 hydrogen bond donor count.
How many hydrogen bond acceptor count does the compound have?
The compound has 3 hydrogen bond acceptor count.
What is the topological polar surface area of the compound?
The topological polar surface area is 67.4 ?2.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.