What is the molecular formula of 1H-Pyrrolo[2,3-b]pyridine,4-chloro-2-iodo-1-(phenylsulfonyl)?
The molecular formula is C13H8ClIN2O2S.
When was the structure of 1H-Pyrrolo[2,3-b]pyridine,4-chloro-2-iodo-1-(phenylsulfonyl) created and modified?
The structure was created on September 16, 2009, and last modified on December 30, 2023.
What is the IUPAC name of 1H-Pyrrolo[2,3-b]pyridine,4-chloro-2-iodo-1-(phenylsulfonyl)?
The IUPAC name is 1-(benzenesulfonyl)-4-chloro-2-iodopyrrolo[2,3-b]pyridine.
What is the InChIKey of 1H-Pyrrolo[2,3-b]pyridine,4-chloro-2-iodo-1-(phenylsulfonyl)?
The InChIKey is QOYGFOVKGYRFHN-UHFFFAOYSA-N.
What is the molecular weight of 1H-Pyrrolo[2,3-b]pyridine,4-chloro-2-iodo-1-(phenylsulfonyl)?
The molecular weight is 418.64 g/mol.
What is the Canonical SMILES representation of 1H-Pyrrolo[2,3-b]pyridine,4-chloro-2-iodo-1-(phenylsulfonyl)?
The Canonical SMILES is C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C(C=CN=C32)Cl)I.
What is the CAS number for 1H-Pyrrolo[2,3-b]pyridine,4-chloro-2-iodo-1-(phenylsulfonyl)?
The CAS number is 940948-30-1.
What is the XLogP3-AA value for 1H-Pyrrolo[2,3-b]pyridine,4-chloro-2-iodo-1-(phenylsulfonyl)?
The XLogP3-AA value is 3.8.
How many hydrogen bond acceptors does 1H-Pyrrolo[2,3-b]pyridine,4-chloro-2-iodo-1-(phenylsulfonyl) have?
It has 3 hydrogen bond acceptors.
Is the compound canonicalized?
Yes, the compound is canonicalized.