The molecular formula of the compound is C20H16F3NO5.
What are the synonyms of the compound?
The synonyms of the compound are 94094-55-0, EINECS 302-157-3, and 4-((4-Hydroxy-3-(1-oxo-3-(3-(trifluoromethyl)phenyl)allyl)phenyl)amino)-4-oxobutyric acid.
What is the molecular weight of the compound?
The molecular weight of the compound is 407.3 g/mol.
When was the compound created?
The compound was created on August 8, 2005.
When was the compound last modified?
The compound was last modified on December 30, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-[4-hydroxy-3-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]anilino]-4-oxobutanoic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C20H16F3NO5/c21-20(22,23)13-3-1-2-12(10-13)4-6-16(25)15-11-14(5-7-17(15)26)24-18(27)8-9-19(28)29/h1-7,10-11,26H,8-9H2,(H,24,27)(H,28,29)/b6-4+.
What is the InChIKey of the compound?
The InChIKey of the compound is YQDHPVFGGUCTPQ-GQCTYLIASA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CC(=C1)C(F)(F)F)C=CC(=O)C2=C(C=CC(=C2)NC(=O)CCC(=O)O)O.
What is the CAS number of the compound?
The CAS number of the compound is 94094-55-0.
※ Please kindly note that our products are for research use only.
Download
![N-[4-Hydroxy-3-[3-[4-[2-morpholinoethoxy]phenyl]acryloyl]phenyl]benzenesulfonamide](https://resource.alfa-chemistry.com/structure/94094-51-6.gif)
![N-[4-Hydroxy-3-[3-[4-[2-(morpholin-4-yl)ethoxy]phenyl]-1-oxoallyl]phenyl]acetamide](https://resource.alfa-chemistry.com/structure/94094-52-7.gif)
![N-[4-Hydroxy-3-[3-[4-[2-(morpholin-4-yl)ethoxy]phenyl]-1-oxovinyl]phenyl]methanesulfonamide](https://resource.alfa-chemistry.com/structure/94094-53-8.gif)
![N-[4-Hydroxy-3-(1-oxo-3-phenylallyl)phenyl]benzenesulfonamide](https://resource.alfa-chemistry.com/structure/94094-59-4.gif)
