CAS
94089-21-1 Purity
---
94089-21-1 Purity
---
Shopping basket
2-Hydroxybutyronitrile
CAS
940899
Catalog Number
ACM940899
Category
Other Products
Molecular Formula
C4H7NO
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
2-Hydroxybutyronitrile;Propionaldehyde cyanohydrin
What is the molecular formula of 2-Hydroxybutyronitrile?
The molecular formula of 2-Hydroxybutyronitrile is C4H7NO.
What is the molecular weight of 2-Hydroxybutyronitrile?
The molecular weight of 2-Hydroxybutyronitrile is 85.10 g/mol.
What is the IUPAC name of 2-Hydroxybutyronitrile?
The IUPAC name of 2-Hydroxybutyronitrile is 2-hydroxybutanenitrile.
What is the InChI of 2-Hydroxybutyronitrile?
The InChI of 2-Hydroxybutyronitrile is InChI=1S/C4H7NO/c1-2-4(6)3-5/h4,6H,2H2,1H3.
What is the InChIKey of 2-Hydroxybutyronitrile?
The InChIKey of 2-Hydroxybutyronitrile is NHSSTOSZJANVEV-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 2-Hydroxybutyronitrile have?
2-Hydroxybutyronitrile has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Hydroxybutyronitrile have?
2-Hydroxybutyronitrile has 2 hydrogen bond acceptor counts.
What is the exact mass of 2-Hydroxybutyronitrile?
The exact mass of 2-Hydroxybutyronitrile is 85.052763847 g/mol.
Is 2-Hydroxybutyronitrile considered to be canonicalized?
Yes, 2-Hydroxybutyronitrile is considered to be canonicalized.
What is the topological polar surface area of 2-Hydroxybutyronitrile?
The topological polar surface area of 2-Hydroxybutyronitrile is 44 Å2.
Recommended Products
CAS
94089-25-5 Purity
---
94089-25-5 Purity
---
![(E)-3-[6-(p-Toluoyl)-2-pyridyl]acrylic acid](https://resource.alfa-chemistry.com/structure/94094-27-6.gif)
