What is the molecular formula of n6-D-Gluconoyl-L-lysine?
The molecular formula of n6-D-Gluconoyl-L-lysine is C12H24N2O8.
When was n6-D-Gluconoyl-L-lysine first created?
n6-D-Gluconoyl-L-lysine was first created on August 20, 2009.
What is the molecular weight of n6-D-Gluconoyl-L-lysine?
The molecular weight of n6-D-Gluconoyl-L-lysine is 324.33 g/mol.
What are some synonyms for n6-D-Gluconoyl-L-lysine?
Some synonyms for n6-D-Gluconoyl-L-lysine include 94071-01-9, EINECS 301-801-0, and DTXSID80240366.
What is the IUPAC name of n6-D-Gluconoyl-L-lysine?
The IUPAC name of n6-D-Gluconoyl-L-lysine is (2S)-2-amino-6-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]hexanoic acid.
What is the Canonical SMILES representation of n6-D-Gluconoyl-L-lysine?
The Canonical SMILES representation of n6-D-Gluconoyl-L-lysine is C(CCNC(=O)C(C(C(C(CO)O)O)O)O)CC(C(=O)O)N.
What is the InChIKey of n6-D-Gluconoyl-L-lysine?
The InChIKey of n6-D-Gluconoyl-L-lysine is FBVIZNUUKKOZQB-LOLPMWEVSA-N.
How many hydrogen bond acceptor counts does n6-D-Gluconoyl-L-lysine have?
n6-D-Gluconoyl-L-lysine has 9 hydrogen bond acceptor counts.
What is the XLogP3-AA value of n6-D-Gluconoyl-L-lysine?
The XLogP3-AA value of n6-D-Gluconoyl-L-lysine is -6.1.
How many defined atom stereocenters does n6-D-Gluconoyl-L-lysine have?
n6-D-Gluconoyl-L-lysine has 5 defined atom stereocenters.