What is the molecular formula of Sorbitan, tri-10-undecenoate?
The molecular formula of Sorbitan, tri-10-undecenoate is C39H66O8.
What is the molecular weight of Sorbitan, tri-10-undecenoate?
The molecular weight of Sorbitan, tri-10-undecenoate is 662.9 g/mol.
When was Sorbitan, tri-10-undecenoate created?
Sorbitan, tri-10-undecenoate was created on August 20, 2009.
What is the IUPAC name of Sorbitan, tri-10-undecenoate?
The IUPAC name of Sorbitan, tri-10-undecenoate is [(3S,4R,5R)-5-[(1R)-2-hydroxy-1-undec-10-enoyloxyethyl]-4-undec-10-enoyloxyoxolan-3-yl] undec-10-enoate.
What is the InChIKey of Sorbitan, tri-10-undecenoate?
The InChIKey of Sorbitan, tri-10-undecenoate is WQLFZTYACWPFGS-UDKDVIIMSA-N.
What is the Canonical SMILES of Sorbitan, tri-10-undecenoate?
The Canonical SMILES of Sorbitan, tri-10-undecenoate is C=CCCCCCCCCC(=O)OC1COC(C1OC(=O)CCCCCCCCC=C)C(CO)OC(=O)CCCCCCCCC=C.
What is the CAS number of Sorbitan, tri-10-undecenoate?
The CAS number of Sorbitan, tri-10-undecenoate is 94043-07-9.
What is the XLogP3-AA value of Sorbitan, tri-10-undecenoate?
The XLogP3-AA value of Sorbitan, tri-10-undecenoate is 11.4.
How many hydrogen bond acceptors does Sorbitan, tri-10-undecenoate have?
Sorbitan, tri-10-undecenoate has 8 hydrogen bond acceptors.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.
Download
![2H-Thiocino[4,5-d]isoxazole(9ci)](https://resource.alfa-chemistry.com/structure/94043-70-6.gif)
![2-(4-Bromophenyl)-5-methylimidazo[2,1-b]benzothiazole](https://resource.alfa-chemistry.com/structure/940438-83-5.gif)
![2-(2,4-Dichlorophenyl)-5-methylimidazo[2,1-b]benzothiazole](https://resource.alfa-chemistry.com/structure/940438-92-6.gif)
