What is the molecular formula of Bazinaprine?
The molecular formula of Bazinaprine is C17H19N5O.
When was Bazinaprine created and modified?
Bazinaprine was created on 2005-08-08 and last modified on 2023-12-30.
What is the IUPAC name of Bazinaprine?
The IUPAC name of Bazinaprine is 3-(2-morpholin-4-ylethylamino)-6-phenylpyridazine-4-carbonitrile.
What is the InChI code of Bazinaprine?
The InChI code of Bazinaprine is InChI=1S/C17H19N5O/c18-13-15-12-16(14-4-2-1-3-5-14)20-21-17(15)19-6-7-22-8-10-23-11-9-22/h1-5,12H,6-11H2,(H,19,21).
What is the InChIKey of Bazinaprine?
The InChIKey of Bazinaprine is KRNDIPHOJLIHRI-UHFFFAOYSA-N.
What is the canonical SMILES of Bazinaprine?
The canonical SMILES of Bazinaprine is C1COCCN1CCNC2=NN=C(C=C2C#N)C3=CC=CC=C3.
What is the CAS number of Bazinaprine?
The CAS number of Bazinaprine is 94011-82-2.
What is the UNII of Bazinaprine?
The UNII of Bazinaprine is NU8Y4C529J.
What is the ChEMBL ID of Bazinaprine?
The ChEMBL ID of Bazinaprine is CHEMBL150365.
Is Bazinaprine a canonicalized compound?
Yes, Bazinaprine is a canonicalized compound.