What is the molecular formula of lipoamide?
The molecular formula of lipoamide is C8H15NOS2.
What is the molecular weight of lipoamide?
The molecular weight of lipoamide is 205.3 g/mol.
What is the IUPAC name of lipoamide?
The IUPAC name of lipoamide is 5-(dithiolan-3-yl)pentanamide.
What is the InChI of lipoamide?
The InChI of lipoamide is InChI=1S/C8H15NOS2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H2,9,10).
What is the InChIKey of lipoamide?
The InChIKey of lipoamide is FCCDDURTIIUXBY-UHFFFAOYSA-N.
What is the canonical SMILES of lipoamide?
The canonical SMILES of lipoamide is C1CSSC1CCCCC(=O)N.
What is the CAS number of lipoamide?
The CAS number of lipoamide is 940-69-2.
What is the ChEMBL ID of lipoamide?
The ChEMBL ID of lipoamide is CHEMBL1403899.
How many hydrogen bond donor counts does lipoamide have?
Lipoamide has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does lipoamide have?
Lipoamide has 3 hydrogen bond acceptor counts.