What is the IUPAC Name of 2,4-Dimethylbenzylamine?
The IUPAC Name of 2,4-Dimethylbenzylamine is (2,4-dimethylphenyl)methanamine.
What is the InChI of 2,4-Dimethylbenzylamine?
The InChI of 2,4-Dimethylbenzylamine is InChI=1S/C9H13N/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6,10H2,1-2H3.
What is the InChIKey of 2,4-Dimethylbenzylamine?
The InChIKey of 2,4-Dimethylbenzylamine is GBSUVYGVEQDZPG-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,4-Dimethylbenzylamine?
The Canonical SMILES of 2,4-Dimethylbenzylamine is CC1=CC(=C(C=C1)CN)C.
What is the molecular weight of 2,4-Dimethylbenzylamine?
The molecular weight of 2,4-Dimethylbenzylamine is 135.21 g/mol.
What is the CAS number of 2,4-Dimethylbenzylamine?
The CAS number of 2,4-Dimethylbenzylamine is 94-98-4.
What is the EC number of 2,4-Dimethylbenzylamine?
The EC number of 2,4-Dimethylbenzylamine is 202-380-5.
What is the UNII of 2,4-Dimethylbenzylamine?
The UNII of 2,4-Dimethylbenzylamine is TQZ4VS5TJQ.
What is the XLogP3-AA value of 2,4-Dimethylbenzylamine?
The XLogP3-AA value of 2,4-Dimethylbenzylamine is 1.5.
Is 2,4-Dimethylbenzylamine a canonicalized compound?
Yes, 2,4-Dimethylbenzylamine is a canonicalized compound.