What is the molecular formula of 1,3-Benzenediamine,4-[2-(4-ethoxyphenyl)diazenyl]?
The molecular formula is C14H16N4O.
What is the molecular weight of 1,3-Benzenediamine,4-[2-(4-ethoxyphenyl)diazenyl]?
The molecular weight is 256.30 g/mol.
What is the IUPAC name of 1,3-Benzenediamine,4-[2-(4-ethoxyphenyl)diazenyl]?
The IUPAC name is 4-[(4-ethoxyphenyl)diazenyl]benzene-1,3-diamine.
What is the InChI of 1,3-Benzenediamine,4-[2-(4-ethoxyphenyl)diazenyl]?
The InChI is InChI=1S/C14H16N4O/c1-2-19-12-6-4-11(5-7-12)17-18-14-8-3-10(15)9-13(14)16/h3-9H,2,15-16H2,1H3.
What is the InChIKey of 1,3-Benzenediamine,4-[2-(4-ethoxyphenyl)diazenyl]?
The InChIKey is GAWOVNGQYQVFLI-UHFFFAOYSA-N.
What is the Canonical SMILES of 1,3-Benzenediamine,4-[2-(4-ethoxyphenyl)diazenyl]?
The Canonical SMILES is CCOC1=CC=C(C=C1)N=NC2=C(C=C(C=C2)N)N.
What is the CAS number for 1,3-Benzenediamine,4-[2-(4-ethoxyphenyl)diazenyl]?
The CAS number is 94-10-0.
What is the ChEMBL ID for 1,3-Benzenediamine,4-[2-(4-ethoxyphenyl)diazenyl]?
The ChEMBL ID is CHEMBL2356984.
How many hydrogen bond acceptor counts does 1,3-Benzenediamine,4-[2-(4-ethoxyphenyl)diazenyl] have?
It has 5 hydrogen bond acceptor counts.
What is the topological polar surface area of 1,3-Benzenediamine,4-[2-(4-ethoxyphenyl)diazenyl]?
The topological polar surface area is 86?2.