What is the molecular formula of sodium trichlorophenate?
The molecular formula of sodium trichlorophenate is C6H2Cl3NaO.
What is the molecular weight of sodium trichlorophenate?
The molecular weight of sodium trichlorophenate is 219.4 g/mol.
What are some synonyms for sodium trichlorophenate?
Some synonyms for sodium trichlorophenate include Sodium 2,3,4-trichlorophenolate, SODIUM TRICHLOROPHENATE, and Sodium trichlorophenolate.
When was sodium trichlorophenate created?
Sodium trichlorophenate was created on February 5, 2008.
What is the IUPAC name of sodium trichlorophenate?
The IUPAC name of sodium trichlorophenate is sodium;2,3,4-trichlorophenolate.
What is the Canonical SMILES representation of sodium trichlorophenate?
The Canonical SMILES representation of sodium trichlorophenate is C1=CC(=C(C(=C1[O-])Cl)Cl)Cl.[Na+].
What is the CAS number of sodium trichlorophenate?
The CAS number of sodium trichlorophenate is 93982-30-0.
How many hydrogen bond acceptor counts does sodium trichlorophenate have?
Sodium trichlorophenate has 1 hydrogen bond acceptor count.
What is the topological polar surface area of sodium trichlorophenate?
The topological polar surface area of sodium trichlorophenate is 23.1 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.