What is the molecular formula of Octyl 2-hexyldecanoate?
The molecular formula of Octyl 2-hexyldecanoate is C24H48O2.
What is the molecular weight of Octyl 2-hexyldecanoate?
The molecular weight of Octyl 2-hexyldecanoate is 368.6 g/mol.
When was Octyl 2-hexyldecanoate created?
Octyl 2-hexyldecanoate was created on August 8, 2005.
What is the IUPAC name of Octyl 2-hexyldecanoate?
The IUPAC name of Octyl 2-hexyldecanoate is octyl 2-hexyldecanoate.
What is the Canonical SMILES of Octyl 2-hexyldecanoate?
The Canonical SMILES of Octyl 2-hexyldecanoate is CCCCCCCCC(CCCCCC)C(=O)OCCCCCCCC.
What is the InChIKey of Octyl 2-hexyldecanoate?
The InChIKey of Octyl 2-hexyldecanoate is BMEOCUNQVBHWRZ-UHFFFAOYSA-N.
How many hydrogen bond acceptors does Octyl 2-hexyldecanoate have?
Octyl 2-hexyldecanoate has 2 hydrogen bond acceptors.
What is the XLogP3-AA value of Octyl 2-hexyldecanoate?
The XLogP3-AA value of Octyl 2-hexyldecanoate is 10.7.
What is the topological polar surface area of Octyl 2-hexyldecanoate?
The topological polar surface area of Octyl 2-hexyldecanoate is 26.3 Ų.
Is Octyl 2-hexyldecanoate a canonical compound?
Yes, Octyl 2-hexyldecanoate is a canonical compound according to PubChem.