What is the molecular formula of [2,2-Bis-(hexyloxy)ethyl]benzene?
The molecular formula of [2,2-Bis-(hexyloxy)ethyl]benzene is C20H34O2.
When was [2,2-Bis-(hexyloxy)ethyl]benzene created on PubChem?
[2,2-Bis-(hexyloxy)ethyl]benzene was created on PubChem on 2005-08-08.
What is the IUPAC name of [2,2-Bis-(hexyloxy)ethyl]benzene?
The IUPAC name of [2,2-Bis-(hexyloxy)ethyl]benzene is 2,2-dihexoxyethylbenzene.
What is the InChI of [2,2-Bis-(hexyloxy)ethyl]benzene?
The InChI of [2,2-Bis-(hexyloxy)ethyl]benzene is InChI=1S/C20H34O2/c1-3-5-7-12-16-21-20(22-17-13-8-6-4-2)18-19-14-10-9-11-15-19/h9-11,14-15,20H,3-8,12-13,16-18H2,1-2H3.
What is the Canonical SMILES of [2,2-Bis-(hexyloxy)ethyl]benzene?
The Canonical SMILES of [2,2-Bis-(hexyloxy)ethyl]benzene is CCCCCCOC(CC1=CC=CC=C1)OCCCCCC.
What is the molecular weight of [2,2-Bis-(hexyloxy)ethyl]benzene?
The molecular weight of [2,2-Bis-(hexyloxy)ethyl]benzene is 306.5 g/mol.
How many hydrogen bond acceptor counts does [2,2-Bis-(hexyloxy)ethyl]benzene have?
[2,2-Bis-(hexyloxy)ethyl]benzene has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of [2,2-Bis-(hexyloxy)ethyl]benzene?
The topological polar surface area of [2,2-Bis-(hexyloxy)ethyl]benzene is 18.5 Å2.
How many rotatable bond counts does [2,2-Bis-(hexyloxy)ethyl]benzene have?
[2,2-Bis-(hexyloxy)ethyl]benzene has 14 rotatable bond counts.
Is the compound canonicalized in PubChem?
Yes, the compound [2,2-Bis-(hexyloxy)ethyl]benzene is canonicalized in PubChem.
※ Please kindly note that our products are for research use only.