What is the molecular formula of Octyl 4-ethyloctanoate?
The molecular formula of Octyl 4-ethyloctanoate is C18H36O2.
What is the molecular weight of Octyl 4-ethyloctanoate?
The molecular weight of Octyl 4-ethyloctanoate is 284.5 g/mol.
When was Octyl 4-ethyloctanoate created according to PubChem?
Octyl 4-ethyloctanoate was created on 2005-08-08.
What is the IUPAC Name of Octyl 4-ethyloctanoate?
The IUPAC Name of Octyl 4-ethyloctanoate is octyl 4-ethyloctanoate.
What is the Canonical SMILES of Octyl 4-ethyloctanoate?
The Canonical SMILES of Octyl 4-ethyloctanoate is CCCCCCCCOC(=O)CCC(CC)CCCC.
How many Hydrogen Bond Acceptor Count does Octyl 4-ethyloctanoate have?
Octyl 4-ethyloctanoate has 2 Hydrogen Bond Acceptor Count.
What is the Heavy Atom Count of Octyl 4-ethyloctanoate?
The Heavy Atom Count of Octyl 4-ethyloctanoate is 20.
Is Octyl 4-ethyloctanoate a Canonicalized compound?
Yes, Octyl 4-ethyloctanoate is a Canonicalized compound.
What is the XLogP3-AA value of Octyl 4-ethyloctanoate?
The XLogP3-AA value of Octyl 4-ethyloctanoate is 7.3.
What is the exact mass of Octyl 4-ethyloctanoate?
The exact mass of Octyl 4-ethyloctanoate is 284.271530387 g/mol.
Download
![2,2'-[Piperazine-1,4-diylbis(thio)]bisbenzothiazole](https://resource.alfa-chemistry.com/structure/93963-17-8.gif)
![3-Chloro-N-[4-chloro-2-(anilino)phenyl]propionamide](https://resource.alfa-chemistry.com/structure/93963-27-0.gif)
![Bicyclo[2.2.1]hept-5-ene-2-carboxylicacid,2-phenyl-,ethyl ester](https://resource.alfa-chemistry.com/structure/93963-29-2.gif)
![Ethyl 2-phenylbicyclo[2.2.1]heptane-2-carboxylate](https://resource.alfa-chemistry.com/structure/93963-32-7.gif)
