What is the molecular formula of 1,3-Butadiene-13c4,1,1,2,3,4,4-hexachloro-(9ci)?
The molecular formula is C4Cl6.
What is the molecular weight of 1,3-Butadiene-13c4,1,1,2,3,4,4-hexachloro-(9ci)?
The molecular weight is 264.7 g/mol.
When was 1,3-Butadiene-13c4,1,1,2,3,4,4-hexachloro-(9ci) created?
It was created on February 16, 2015.
When was 1,3-Butadiene-13c4,1,1,2,3,4,4-hexachloro-(9ci) last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of 1,3-Butadiene-13c4,1,1,2,3,4,4-hexachloro-(9ci)?
The IUPAC name is 1,1,2,3,4,4-hexachloro(1,2,3,4-13C4)buta-1,3-diene.
What is the InChI of 1,3-Butadiene-13c4,1,1,2,3,4,4-hexachloro-(9ci)?
The InChI is InChI=1S/C4Cl6/c5-1(3(7)8)2(6)4(9)10/i1+1,2+1,3+1,4+1.
What is the InChIKey of 1,3-Butadiene-13c4,1,1,2,3,4,4-hexachloro-(9ci)?
The InChIKey is RWNKSTSCBHKHTB-JCDJMFQYSA-N.
What is the canonical SMILES of 1,3-Butadiene-13c4,1,1,2,3,4,4-hexachloro-(9ci)?
The canonical SMILES is C(=C(Cl)Cl)(C(=C(Cl)Cl)Cl)Cl.
What is the CAS number of 1,3-Butadiene-13c4,1,1,2,3,4,4-hexachloro-(9ci)?
The CAS number is 93951-70-3.
What is the monoisotopic mass of 1,3-Butadiene-13c4,1,1,2,3,4,4-hexachloro-(9ci)?
The monoisotopic mass is 261.826536 g/mol.