What is the molecular formula of Alpha-methyl-N,N-bis[4-(1-phenylethyl)phenyl]benzylamine?
The molecular formula is C36H35N.
When was Alpha-methyl-N,N-bis[4-(1-phenylethyl)phenyl]benzylamine created?
It was created on August 20, 2009.
What is the IUPAC name of Alpha-methyl-N,N-bis[4-(1-phenylethyl)phenyl]benzylamine?
The IUPAC name is N,4-bis(1-phenylethyl)-N-[4-(1-phenylethyl)phenyl]aniline.
What is the InChIKey of Alpha-methyl-N,N-bis[4-(1-phenylethyl)phenyl]benzylamine?
The InChIKey is CJUSADBOQLQVKK-UHFFFAOYSA-N.
What is the Canonical SMILES of Alpha-methyl-N,N-bis[4-(1-phenylethyl)phenyl]benzylamine?
The Canonical SMILES is CC(C1=CC=CC=C1)C2=CC=C(C=C2)N(C3=CC=C(C=C3)C(C)C4=CC=CC=C4)C(C)C5=CC=CC=C5.
What is the molecular weight of Alpha-methyl-N,N-bis[4-(1-phenylethyl)phenyl]benzylamine?
The molecular weight is 481.7 g/mol.
How many hydrogen bond donor counts does Alpha-methyl-N,N-bis[4-(1-phenylethyl)phenyl]benzylamine have?
It has 0 hydrogen bond donor counts.
How many rotatable bond counts does Alpha-methyl-N,N-bis[4-(1-phenylethyl)phenyl]benzylamine have?
It has 8 rotatable bond counts.
What is the topological polar surface area of Alpha-methyl-N,N-bis[4-(1-phenylethyl)phenyl]benzylamine?
The topological polar surface area is 3.2 2.
Is the compound canonicalized for Alpha-methyl-N,N-bis[4-(1-phenylethyl)phenyl]benzylamine?
Yes, the compound is canonicalized.