What is the molecular formula of N-Isoicosylacrylamide?
The molecular formula of N-Isoicosylacrylamide is C23H45NO.
When was N-Isoicosylacrylamide created and last modified?
N-Isoicosylacrylamide was created on 2009-08-20 and last modified on 2023-12-30.
What is the IUPAC name of N-Isoicosylacrylamide?
The IUPAC name of N-Isoicosylacrylamide is N-(18-methylnonadecyl)prop-2-enamide.
What is the InChI of N-Isoicosylacrylamide?
The InChI of N-Isoicosylacrylamide is InChI=1S/C23H45NO/c1-4-23(25)24-21-19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-22(2)3/h4,22H,1,5-21H2,2-3H3,(H,24,25).
What is the molecular weight of N-Isoicosylacrylamide?
The molecular weight of N-Isoicosylacrylamide is 351.6 g/mol.
How many hydrogen bond donor counts does N-Isoicosylacrylamide have?
N-Isoicosylacrylamide has 1 hydrogen bond donor count.
What is the XLogP3-AA value of N-Isoicosylacrylamide?
The XLogP3-AA value of N-Isoicosylacrylamide is 9.8.
How many rotatable bond counts does N-Isoicosylacrylamide have?
N-Isoicosylacrylamide has 19 rotatable bond counts.
What is the topological polar surface area of N-Isoicosylacrylamide?
The topological polar surface area of N-Isoicosylacrylamide is 29.1 Å2.
Is the compound canonicalized?
Yes, the compound is canonicalized.