The molecular formula of the compound is C25H24N2O7.
What are the synonyms of the compound?
The synonyms of the compound include 93804-96-7 and EINECS 298-475-4.
When was the compound created and modified?
The compound was created on 2009-08-20 and modified on 2023-12-30.
What is the IUPAC Name of the compound?
The IUPAC Name of the compound is 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.0 2,10 .0 4,8 .0 15,20 ]henicosa-1(13),2,4(8),9,14,16,18,20-octaene;(2S)-5-oxopyrrolidine-2-carboxylate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C20H18NO4.C5H7NO3/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2;7-4-2-1-3(6-4)5(8)9/h3-4,7-10H,5-6,11H2,1-2H3;3H,1-2H2,(H,6,7)(H,8,9)/q+1;/p-1/t;3-/m.0/s1.
What is the InChIKey of the compound?
The InChIKey of the compound is GFNVLLKVQVYDNO-HVDRVSQOSA-M.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.C1CC(=O)NC1C(=O)[O-].
What is the molecular weight of the compound?
The molecular weight of the compound is 464.5 g/mol.
How many hydrogen bond acceptors does the compound have?
The compound has 7 hydrogen bond acceptors.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.