What is the molecular formula of Octyl 2-ethylhexanoate?
The molecular formula of Octyl 2-ethylhexanoate is C16H32O2.
What is the molecular weight of Octyl 2-ethylhexanoate?
The molecular weight of Octyl 2-ethylhexanoate is 256.42 g/mol.
What is the IUPAC name of Octyl 2-ethylhexanoate?
The IUPAC name of Octyl 2-ethylhexanoate is octyl 2-ethylhexanoate.
What is the InChI code for Octyl 2-ethylhexanoate?
The InChI code for Octyl 2-ethylhexanoate is InChI=1S/C16H32O2/c1-4-7-9-10-11-12-14-18-16(17)15(6-3)13-8-5-2/h15H,4-14H2,1-3H3.
What is the InChIKey of Octyl 2-ethylhexanoate?
The InChIKey of Octyl 2-ethylhexanoate is LGCQCKHJCZIRTE-UHFFFAOYSA-N.
What is the canonical SMILES of Octyl 2-ethylhexanoate?
The canonical SMILES of Octyl 2-ethylhexanoate is CCCCCCCCOC(=O)C(CC)CCCC.
What is the CAS number of Octyl 2-ethylhexanoate?
The CAS number of Octyl 2-ethylhexanoate is 93777-45-8.
What is the European Community (EC) number of Octyl 2-ethylhexanoate?
The European Community (EC) number of Octyl 2-ethylhexanoate is 298-077-0.
What is the XLogP3-AA value of Octyl 2-ethylhexanoate?
The XLogP3-AA value of Octyl 2-ethylhexanoate is 6.4.
Is Octyl 2-ethylhexanoate a canonicalized compound?
Yes, Octyl 2-ethylhexanoate is a canonicalized compound according to PubChem.