What is the molecular formula of Calcium 2,5-dimethyl-3,4-dithioxoadipate?
The molecular formula is C8H8CaO4S2.
When was Calcium 2,5-dimethyl-3,4-dithioxoadipate created and modified in PubChem?
It was created on 2005-08-08 and modified on 2023-12-30.
What is the IUPAC name of Calcium 2,5-dimethyl-3,4-dithioxoadipate?
The IUPAC name is calcium;2,5-dimethyl-3,4-bis(sulfanylidene)hexanedioate.
What is the InChIKey of Calcium 2,5-dimethyl-3,4-dithioxoadipate?
The InChIKey is ADRVTASORWAZLS-UHFFFAOYSA-L.
What is the Canonical SMILES representation of Calcium 2,5-dimethyl-3,4-dithioxoadipate?
The Canonical SMILES is CC(C(=S)C(=S)C(C)C(=O)[O-])C(=O)[O-].[Ca+2].
What is the molecular weight of Calcium 2,5-dimethyl-3,4-dithioxoadipate?
The molecular weight is 272.4 g/mol.
What is the CAS number of Calcium 2,5-dimethyl-3,4-dithioxoadipate?
The CAS number is 93776-78-4.
How many hydrogen bond acceptor counts does Calcium 2,5-dimethyl-3,4-dithioxoadipate have?
It has 6 hydrogen bond acceptor counts.
What is the topological polar surface area of Calcium 2,5-dimethyl-3,4-dithioxoadipate?
The topological polar surface area is 144 Ų.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.