What is the molecular formula of 5-Thiazolecarboxaldehyde,2-methoxy-4-methyl according to the reference?
The molecular formula is C6H7NO2S.
What is the molecular weight of 5-Thiazolecarboxaldehyde,2-methoxy-4-methyl?
The molecular weight is 157.19 g/mol.
What is the IUPAC name of 5-Thiazolecarboxaldehyde,2-methoxy-4-methyl?
The IUPAC name is 2-methoxy-4-methyl-1,3-thiazole-5-carbaldehyde.
What is the InChI of 5-Thiazolecarboxaldehyde,2-methoxy-4-methyl?
The InChI is InChI=1S/C6H7NO2S/c1-4-5(3-8)10-6(7-4)9-2/h3H,1-2H3.
What is the InChIKey of 5-Thiazolecarboxaldehyde,2-methoxy-4-methyl?
The InChIKey is FGAIXPLELSFGEW-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-Thiazolecarboxaldehyde,2-methoxy-4-methyl?
The Canonical SMILES is CC1=C(SC(=N1)OC)C=O.
How many hydrogen bond acceptor counts does 5-Thiazolecarboxaldehyde,2-methoxy-4-methyl have?
It has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of 5-Thiazolecarboxaldehyde,2-methoxy-4-methyl?
The topological polar surface area is 67.4 Ų.
How many rotatable bond counts does 5-Thiazolecarboxaldehyde,2-methoxy-4-methyl have?
It has 2 rotatable bond counts.
Is 5-Thiazolecarboxaldehyde,2-methoxy-4-methyl a canonicalized compound?
Yes, the compound is canonicalized according to the reference.