937594-14-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H14BClFNO2.
The PubChem CID of the compound is 53398378.
The IUPAC name of the compound is 5-chloro-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
The InChI of the compound is InChI=1S/C11H14BClFNO2/c1-10(2)11(3,4)17-12(16-10)8-5-7(13)6-15-9(8)14/h5-6H,1-4H3.
The InChIKey of the compound is FTJNVYIGHAMRQU-UHFFFAOYSA-N.
The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2F)Cl.
The molecular weight of the compound is 257.50 g/mol.
The compound has 0 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.
No, the compound does not have any defined atom stereocenter count.
×
Download