What is the molecular formula of Carbonochloridic acid, 4-methylphenyl ester?
The molecular formula is C8H7ClO2.
What is the molecular weight of Carbonochloridic acid, 4-methylphenyl ester?
The molecular weight is 170.59 g/mol.
What is the IUPAC name of Carbonochloridic acid, 4-methylphenyl ester?
The IUPAC name is (4-methylphenyl) carbonochloridate.
What is the InChI of Carbonochloridic acid, 4-methylphenyl ester?
The InChI is "InChI=1S/C8H7ClO2/c1-6-2-4-7(5-3-6)11-8(9)10/h2-5H,1H3".
What is the InChIKey of Carbonochloridic acid, 4-methylphenyl ester?
The InChIKey is "XOFZPIYYMJUNRG-UHFFFAOYSA-N".
What is the Canonical SMILES of Carbonochloridic acid, 4-methylphenyl ester?
The Canonical SMILES is "CC1=CC=C(C=C1)OC(=O)Cl".
What other identifiers are associated with Carbonochloridic acid, 4-methylphenyl ester?
The other identifiers include CAS numbers: 937-62-2, 52286-75-6; European Community (EC) numbers: 257-815-1, 213-332-8; DSSTox Substance ID: DTXSID80918199; Nikkaji Number: J265.444J; and Wikidata: Q82890162.
What is the XLogP3 value of Carbonochloridic acid, 4-methylphenyl ester?
The XLogP3 value is 3.2.
How many hydrogen bond acceptors does Carbonochloridic acid, 4-methylphenyl ester have?
Carbonochloridic acid, 4-methylphenyl ester has 2 hydrogen bond acceptors.
※ Please kindly note that our products are for research use only.